C30H39F3N4O3 — CID 175988391
tert-butyl 3-[[(1S)-1-[5-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 175988391) has the molecular formula C30H39F3N4O3 and a molecular weight of 560.66 g/mol. Its IUPAC name is tert-butyl 3-[[(1S)-1-[5-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(1S)-1-[5-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175988391 |
| Molecular Formula | C30H39F3N4O3 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | tert-butyl 3-[[(1S)-1-[5-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CN(C(=O)C1CCCN(C(=O)OC(C)(C)C)C1)[C@@H](c1ccc(NC2Cc3ccccc3C2(C)C)cn1)C(F)(F)F |
| InChI | InChI=1S/C30H39F3N4O3/c1-28(2,3)40-27(39)37-15-9-11-20(18-37)26(38)36(6)25(30(31,32)33)23-14-13-21(17-34-23)35-24-16-19-10-7-8-12-22(19)29(24,4)5/h7-8,10,12-14,17,20,24-25,35H,9,11,15-16,18H2,1-6H3/t20?,24?,25-/m0/s1 |
| InChIKey | UNOCZGHGQWVZQI-VZTJNBFISA-N |
| XLogP | 6.10 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |