C30H42F3N3O2Si — CID 174145232
N-[(1S)-1-[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N,4-dimethyl-4-trimethylsilyloxypiperidine-1-carboxamide (PubChem CID 174145232) has the molecular formula C30H42F3N3O2Si and a molecular weight of 561.77 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N,4-dimethyl-4-trimethylsilyloxypiperidine-1-carboxamide.
| Compound Name | N-[(1S)-1-[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N,4-dimethyl-4-trimethylsilyloxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 174145232 |
| Molecular Formula | C30H42F3N3O2Si |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | N-[(1S)-1-[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N,4-dimethyl-4-trimethylsilyloxypiperidine-1-carboxamide |
| SMILES | CN(C(=O)N1CCC(C)(O[Si](C)(C)C)CC1)[C@@H](c1ccc(NC2Cc3ccccc3C2(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H42F3N3O2Si/c1-28(2)24-11-9-8-10-22(24)20-25(28)34-23-14-12-21(13-15-23)26(30(31,32)33)35(4)27(37)36-18-16-29(3,17-19-36)38-39(5,6)7/h8-15,25-26,34H,16-20H2,1-7H3/t25?,26-/m0/s1 |
| InChIKey | CTNSGRMLRKRASV-AMVUTOCUSA-N |
| XLogP | 7.36 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|