C26H31F3N4O3 — CID 170331176
[(1S,3R)-3-[[(1S)-1-[5-[[(2R)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl] carbamate (PubChem CID 170331176) has the molecular formula C26H31F3N4O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is [(1S,3R)-3-[[(1S)-1-[5-[[(2R)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl] carbamate.
| Compound Name | [(1S,3R)-3-[[(1S)-1-[5-[[(2R)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl] carbamate |
|---|---|
| PubChem CID | 170331176 |
| Molecular Formula | C26H31F3N4O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [(1S,3R)-3-[[(1S)-1-[5-[[(2R)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl] carbamate |
| SMILES | CN(C(=O)[C@@H]1CC[C@H](OC(N)=O)C1)[C@@H](c1ccc(N[C@@H]2Cc3ccccc3C2(C)C)cn1)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N4O3/c1-25(2)19-7-5-4-6-15(19)13-21(25)32-17-9-11-20(31-14-17)22(26(27,28)29)33(3)23(34)16-8-10-18(12-16)36-24(30)35/h4-7,9,11,14,16,18,21-22,32H,8,10,12-13H2,1-3H3,(H2,30,35)/t16-,18+,21-,22+/m1/s1 |
| InChIKey | HBWAWODAZXPLOY-JSOTWZDUSA-N |
| XLogP | 4.72 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |