C26H31F3N4O3 — CID 170331825
[(1R,3S)-3-[[1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl]carbamic acid (PubChem CID 170331825) has the molecular formula C26H31F3N4O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is [(1R,3S)-3-[[1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl]carbamic acid.
| Compound Name | [(1R,3S)-3-[[1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 170331825 |
| Molecular Formula | C26H31F3N4O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [(1R,3S)-3-[[1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-methylcarbamoyl]cyclopentyl]carbamic acid |
| SMILES | CN(C(=O)[C@H]1CC[C@@H](NC(=O)O)C1)C(c1ccc(N[C@H]2Cc3ccccc3C2(C)C)cn1)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N4O3/c1-25(2)19-7-5-4-6-15(19)13-21(25)31-18-10-11-20(30-14-18)22(26(27,28)29)33(3)23(34)16-8-9-17(12-16)32-24(35)36/h4-7,10-11,14,16-17,21-22,31-32H,8-9,12-13H2,1-3H3,(H,35,36)/t16-,17+,21-,22?/m0/s1 |
| InChIKey | VRRXBLIUOIIBJS-LQZGFOBXSA-N |
| XLogP | 4.89 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |