C16H24BN3O3 — CID 175988648
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-3-oxa-8-azabicyclo[3.2.1]octane (PubChem CID 175988648) has the molecular formula C16H24BN3O3 and a molecular weight of 317.20 g/mol. Its IUPAC name is 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-3-oxa-8-azabicyclo[3.2.1]octane.
| Compound Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-3-oxa-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 175988648 |
| Molecular Formula | C16H24BN3O3 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-3-oxa-8-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)OB(c2cnc(C34CCC(COC3)N4)nc2)OC1(C)C |
| InChI | InChI=1S/C16H24BN3O3/c1-14(2)15(3,4)23-17(22-14)11-7-18-13(19-8-11)16-6-5-12(20-16)9-21-10-16/h7-8,12,20H,5-6,9-10H2,1-4H3 |
| InChIKey | FEOJHEIKXABCCT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|