About 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride
4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride (PubChem CID 175988955) has the molecular formula C17H33ClO4
and a molecular weight of 336.90 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride |
| PubChem CID | 175988955 |
| Molecular Formula | C17H33ClO4 |
| Molecular Weight | 336.90 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride |
| SMILES | CCCCCCCC(C(=O)OC)C(C)C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C17H32O4.ClH/c1-7-8-9-10-11-12-14(16(19)20-6)13(2)15(18)21-17(3,4)5;/h13-14H,7-12H2,1-6H3;1H |
| InChIKey | ACCFKUDTCCDWPL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride?
The IUPAC name of 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride (CID 175988955) is 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride.
What is the SMILES notation for 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride?
The canonical SMILES for 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride is CCCCCCCC(C(=O)OC)C(C)C(=O)OC(C)(C)C.Cl.
What is the InChIKey of 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride?
The InChIKey is ACCFKUDTCCDWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4.ClH/c1-7-8-9-10-11-12-14(16(19)20-6)13(2)15(18)21-17(3,4)5;/h13-14H,7-12H2,1-6H3;1H.
What are the key properties of 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride?
4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride has a molecular weight of 336.90 g/mol, XLogP of 4.54, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-methyl 2-heptyl-3-methylbutanedioate;hydrochloride is sourced from PubChem (CID 175988955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).