C13H17ClN4O2S — CID 175991248
6-chloro-3-[3-(ethylsulfonylmethyl)pyrrolidin-1-yl]-1H-pyrazolo[4,3-c]pyridine (PubChem CID 175991248) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.83 g/mol. Its IUPAC name is 6-chloro-3-[3-(ethylsulfonylmethyl)pyrrolidin-1-yl]-1H-pyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-[3-(ethylsulfonylmethyl)pyrrolidin-1-yl]-1H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 175991248 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 6-chloro-3-[3-(ethylsulfonylmethyl)pyrrolidin-1-yl]-1H-pyrazolo[4,3-c]pyridine |
| SMILES | CCS(=O)(=O)CC1CCN(c2n[nH]c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C13H17ClN4O2S/c1-2-21(19,20)8-9-3-4-18(7-9)13-10-6-15-12(14)5-11(10)16-17-13/h5-6,9H,2-4,7-8H2,1H3,(H,16,17) |
| InChIKey | NIMPBNODHKVKGW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|