C12H16ClN5 — CID 170576993
1-(6-chloro-1H-pyrazolo[4,3-c]pyridin-3-yl)-N,5-dimethylpyrrolidin-3-amine (PubChem CID 170576993) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is 1-(6-chloro-1H-pyrazolo[4,3-c]pyridin-3-yl)-N,5-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(6-chloro-1H-pyrazolo[4,3-c]pyridin-3-yl)-N,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 170576993 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-(6-chloro-1H-pyrazolo[4,3-c]pyridin-3-yl)-N,5-dimethylpyrrolidin-3-amine |
| SMILES | CNC1CC(C)N(c2n[nH]c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C12H16ClN5/c1-7-3-8(14-2)6-18(7)12-9-5-15-11(13)4-10(9)16-17-12/h4-5,7-8,14H,3,6H2,1-2H3,(H,16,17) |
| InChIKey | PXBYFFVBFDWJON-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|