C15H18ClN3O — CID 166547316
(2R,3R)-1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)-2-methylazetidin-3-ol (PubChem CID 166547316) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is (2R,3R)-1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)-2-methylazetidin-3-ol.
| Compound Name | (2R,3R)-1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)-2-methylazetidin-3-ol |
|---|---|
| PubChem CID | 166547316 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2R,3R)-1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)-2-methylazetidin-3-ol |
| SMILES | CC(C)c1cnc(N2C[C@@H](O)[C@H]2C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H18ClN3O/c1-8(2)11-5-18-15(19-7-13(20)9(19)3)12-6-17-14(16)4-10(11)12/h4-6,8-9,13,20H,7H2,1-3H3/t9-,13-/m1/s1 |
| InChIKey | USLLJPCYNAEQAU-NOZJJQNGSA-N |
| XLogP | 2.98 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|