C17H21ClN2O2S — CID 170710889
3-chloro-8-[(2R,3S)-2-methyl-3-methylsulfonylazetidin-1-yl]-5-propan-2-ylisoquinoline (PubChem CID 170710889) has the molecular formula C17H21ClN2O2S and a molecular weight of 352.89 g/mol. Its IUPAC name is 3-chloro-8-[(2R,3S)-2-methyl-3-methylsulfonylazetidin-1-yl]-5-propan-2-ylisoquinoline.
| Compound Name | 3-chloro-8-[(2R,3S)-2-methyl-3-methylsulfonylazetidin-1-yl]-5-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 170710889 |
| Molecular Formula | C17H21ClN2O2S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3-chloro-8-[(2R,3S)-2-methyl-3-methylsulfonylazetidin-1-yl]-5-propan-2-ylisoquinoline |
| SMILES | CC(C)c1ccc(N2C[C@H](S(C)(=O)=O)[C@H]2C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C17H21ClN2O2S/c1-10(2)12-5-6-15(14-8-19-17(18)7-13(12)14)20-9-16(11(20)3)23(4,21)22/h5-8,10-11,16H,9H2,1-4H3/t11-,16+/m1/s1 |
| InChIKey | DYGROTKFIXMEPD-BZNIZROVSA-N |
| XLogP | 3.63 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|