C18H23ClN2OS — CID 170160424
3-chloro-8-[3-(2-methylsulfinylethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline (PubChem CID 170160424) has the molecular formula C18H23ClN2OS and a molecular weight of 350.92 g/mol. Its IUPAC name is 3-chloro-8-[3-(2-methylsulfinylethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline.
| Compound Name | 3-chloro-8-[3-(2-methylsulfinylethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 170160424 |
| Molecular Formula | C18H23ClN2OS |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-chloro-8-[3-(2-methylsulfinylethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline |
| SMILES | CC(C)c1ccc(N2CC(CCS(C)=O)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C18H23ClN2OS/c1-12(2)14-4-5-17(16-9-20-18(19)8-15(14)16)21-10-13(11-21)6-7-23(3)22/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3 |
| InChIKey | FPIQAEQWDWSACB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|