C18H24ClN3S — CID 170049773
1-(3-chloro-5-propan-2-ylisoquinolin-8-yl)-N-propylsulfanylazetidin-3-amine (PubChem CID 170049773) has the molecular formula C18H24ClN3S and a molecular weight of 349.93 g/mol. Its IUPAC name is 1-(3-chloro-5-propan-2-ylisoquinolin-8-yl)-N-propylsulfanylazetidin-3-amine.
| Compound Name | 1-(3-chloro-5-propan-2-ylisoquinolin-8-yl)-N-propylsulfanylazetidin-3-amine |
|---|---|
| PubChem CID | 170049773 |
| Molecular Formula | C18H24ClN3S |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-(3-chloro-5-propan-2-ylisoquinolin-8-yl)-N-propylsulfanylazetidin-3-amine |
| SMILES | CCCSNC1CN(c2ccc(C(C)C)c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C18H24ClN3S/c1-4-7-23-21-13-10-22(11-13)17-6-5-14(12(2)3)15-8-18(19)20-9-16(15)17/h5-6,8-9,12-13,21H,4,7,10-11H2,1-3H3 |
| InChIKey | UZTHBYSCEAULGH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|