C17H20ClFN2S — CID 156802213
3-chloro-7-fluoro-8-[3-(methylsulfanylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline (PubChem CID 156802213) has the molecular formula C17H20ClFN2S and a molecular weight of 338.88 g/mol. Its IUPAC name is 3-chloro-7-fluoro-8-[3-(methylsulfanylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline.
| Compound Name | 3-chloro-7-fluoro-8-[3-(methylsulfanylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 156802213 |
| Molecular Formula | C17H20ClFN2S |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-chloro-7-fluoro-8-[3-(methylsulfanylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinoline |
| SMILES | CSCC1CN(c2c(F)cc(C(C)C)c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C17H20ClFN2S/c1-10(2)12-4-15(19)17(21-7-11(8-21)9-22-3)14-6-20-16(18)5-13(12)14/h4-6,10-11H,7-9H2,1-3H3 |
| InChIKey | UKMYKKUFEBFALC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|