C17H25ClN4 — CID 166547202
1-(azetidin-1-yl)-6-chloro-4-propan-2-yl-2,7-naphthyridine;N,N-dimethylmethanamine (PubChem CID 166547202) has the molecular formula C17H25ClN4 and a molecular weight of 320.87 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-6-chloro-4-propan-2-yl-2,7-naphthyridine;N,N-dimethylmethanamine.
| Compound Name | 1-(azetidin-1-yl)-6-chloro-4-propan-2-yl-2,7-naphthyridine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 166547202 |
| Molecular Formula | C17H25ClN4 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-(azetidin-1-yl)-6-chloro-4-propan-2-yl-2,7-naphthyridine;N,N-dimethylmethanamine |
| SMILES | CC(C)c1cnc(N2CCC2)c2cnc(Cl)cc12.CN(C)C |
| InChI | InChI=1S/C14H16ClN3.C3H9N/c1-9(2)11-7-17-14(18-4-3-5-18)12-8-16-13(15)6-10(11)12;1-4(2)3/h6-9H,3-5H2,1-2H3;1-3H3 |
| InChIKey | ZRYYTZJESTWDGM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|