C17H16ClN3O4 — CID 166547286
dimethyl 2-[[1-(azetidin-1-yl)-6-chloro-2,7-naphthyridin-4-yl]methylidene]propanedioate (PubChem CID 166547286) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is dimethyl 2-[[1-(azetidin-1-yl)-6-chloro-2,7-naphthyridin-4-yl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[1-(azetidin-1-yl)-6-chloro-2,7-naphthyridin-4-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 166547286 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | dimethyl 2-[[1-(azetidin-1-yl)-6-chloro-2,7-naphthyridin-4-yl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cnc(N2CCC2)c2cnc(Cl)cc12)C(=O)OC |
| InChI | InChI=1S/C17H16ClN3O4/c1-24-16(22)12(17(23)25-2)6-10-8-20-15(21-4-3-5-21)13-9-19-14(18)7-11(10)13/h6-9H,3-5H2,1-2H3 |
| InChIKey | ABWCTUUDFPFILU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|