C16H20ClN3 — CID 175554472
6-chloro-1-[(2S)-2-methylpyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine (PubChem CID 175554472) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is 6-chloro-1-[(2S)-2-methylpyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine.
| Compound Name | 6-chloro-1-[(2S)-2-methylpyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine |
|---|---|
| PubChem CID | 175554472 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 6-chloro-1-[(2S)-2-methylpyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine |
| SMILES | CC(C)c1cnc(N2CCC[C@@H]2C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H20ClN3/c1-10(2)13-8-19-16(20-6-4-5-11(20)3)14-9-18-15(17)7-12(13)14/h7-11H,4-6H2,1-3H3/t11-/m0/s1 |
| InChIKey | SCRBZPGTGWZPOQ-NSHDSACASA-N |
| XLogP | 4.40 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|