C17H21ClN4O — CID 166546779
N-[[1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)azetidin-2-yl]methyl]acetamide (PubChem CID 166546779) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is N-[[1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)azetidin-2-yl]methyl]acetamide.
| Compound Name | N-[[1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)azetidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 166546779 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[[1-(6-chloro-4-propan-2-yl-2,7-naphthyridin-1-yl)azetidin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN1c1ncc(C(C)C)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C17H21ClN4O/c1-10(2)14-8-21-17(15-9-20-16(18)6-13(14)15)22-5-4-12(22)7-19-11(3)23/h6,8-10,12H,4-5,7H2,1-3H3,(H,19,23) |
| InChIKey | IWQZYVIGFIWBIS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|