C16H16ClF2N3 — CID 166547154
6-chloro-1-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-4-propan-2-yl-2,7-naphthyridine (PubChem CID 166547154) has the molecular formula C16H16ClF2N3 and a molecular weight of 323.77 g/mol. Its IUPAC name is 6-chloro-1-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-4-propan-2-yl-2,7-naphthyridine.
| Compound Name | 6-chloro-1-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-4-propan-2-yl-2,7-naphthyridine |
|---|---|
| PubChem CID | 166547154 |
| Molecular Formula | C16H16ClF2N3 |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 6-chloro-1-(2,2-difluoro-5-azaspiro[2.3]hexan-5-yl)-4-propan-2-yl-2,7-naphthyridine |
| SMILES | CC(C)c1cnc(N2CC3(C2)CC3(F)F)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H16ClF2N3/c1-9(2)11-4-21-14(12-5-20-13(17)3-10(11)12)22-7-15(8-22)6-16(15,18)19/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | JXYFPMQMJMDXQB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|