C19H21ClN2O2S — CID 166550102
3-chloro-8-[(2S,3R)-6-methylidene-2-methylsulfonyl-5-azaspiro[2.3]hexan-5-yl]-5-propan-2-ylisoquinoline (PubChem CID 166550102) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is 3-chloro-8-[(2S,3R)-6-methylidene-2-methylsulfonyl-5-azaspiro[2.3]hexan-5-yl]-5-propan-2-ylisoquinoline.
| Compound Name | 3-chloro-8-[(2S,3R)-6-methylidene-2-methylsulfonyl-5-azaspiro[2.3]hexan-5-yl]-5-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 166550102 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-chloro-8-[(2S,3R)-6-methylidene-2-methylsulfonyl-5-azaspiro[2.3]hexan-5-yl]-5-propan-2-ylisoquinoline |
| SMILES | C=C1N(c2ccc(C(C)C)c3cc(Cl)ncc23)C[C@]12C[C@@H]2S(C)(=O)=O |
| InChI | InChI=1S/C19H21ClN2O2S/c1-11(2)13-5-6-16(15-9-21-18(20)7-14(13)15)22-10-19(12(22)3)8-17(19)25(4,23)24/h5-7,9,11,17H,3,8,10H2,1-2,4H3/t17-,19+/m0/s1 |
| InChIKey | JGNNEZULGHEEKI-PKOBYXMFSA-N |
| XLogP | 4.15 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|