C19H18BN3O3 — CID 175991372
[3-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-c]quinolin-8-yl]boronic acid (PubChem CID 175991372) has the molecular formula C19H18BN3O3 and a molecular weight of 347.18 g/mol. Its IUPAC name is [3-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-c]quinolin-8-yl]boronic acid.
| Compound Name | [3-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-c]quinolin-8-yl]boronic acid |
|---|---|
| PubChem CID | 175991372 |
| Molecular Formula | C19H18BN3O3 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [3-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-c]quinolin-8-yl]boronic acid |
| SMILES | COc1ccc(Cn2c(C)nc3c4cc(B(O)O)ccc4ncc32)cc1 |
| InChI | InChI=1S/C19H18BN3O3/c1-12-22-19-16-9-14(20(24)25)5-8-17(16)21-10-18(19)23(12)11-13-3-6-15(26-2)7-4-13/h3-10,24-25H,11H2,1-2H3 |
| InChIKey | YBSLWRTWBMNZGA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|