C21H21Cl2N3O — CID 167224031
1-[(3,4-dichlorophenyl)methyl]-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-2-methylimidazo[4,5-b]pyridine (PubChem CID 167224031) has the molecular formula C21H21Cl2N3O and a molecular weight of 402.33 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-2-methylimidazo[4,5-b]pyridine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-2-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 167224031 |
| Molecular Formula | C21H21Cl2N3O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]-2-methylimidazo[4,5-b]pyridine |
| SMILES | C=C(C)/C(=C(/C)OC)c1cnc2nc(C)n(Cc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C21H21Cl2N3O/c1-12(2)20(13(3)27-5)16-9-19-21(24-10-16)25-14(4)26(19)11-15-6-7-17(22)18(23)8-15/h6-10H,1,11H2,2-5H3/b20-13+ |
| InChIKey | NMMSCAIRDXSATH-DEDYPNTBSA-N |
| XLogP | 6.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|