C14H10F2IN3 — CID 138522407
1-[(3,4-difluorophenyl)methyl]-6-iodo-2-methylimidazo[4,5-b]pyridine (PubChem CID 138522407) has the molecular formula C14H10F2IN3 and a molecular weight of 385.16 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-6-iodo-2-methylimidazo[4,5-b]pyridine.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-6-iodo-2-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138522407 |
| Molecular Formula | C14H10F2IN3 |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-6-iodo-2-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1nc2ncc(I)cc2n1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10F2IN3/c1-8-19-14-13(5-10(17)6-18-14)20(8)7-9-2-3-11(15)12(16)4-9/h2-6H,7H2,1H3 |
| InChIKey | DDRPJTWZFVFZQW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|