C10H7F2IN2 — CID 78997583
1-[(3,4-difluorophenyl)methyl]-4-iodopyrazole (PubChem CID 78997583) has the molecular formula C10H7F2IN2 and a molecular weight of 320.08 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-iodopyrazole.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-iodopyrazole |
|---|---|
| PubChem CID | 78997583 |
| Molecular Formula | C10H7F2IN2 |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-iodopyrazole |
| SMILES | Fc1ccc(Cn2cc(I)cn2)cc1F |
| InChI | InChI=1S/C10H7F2IN2/c11-9-2-1-7(3-10(9)12)5-15-6-8(13)4-14-15/h1-4,6H,5H2 |
| InChIKey | HZOWKEUWSDHYRC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|