C15H19FIN3 — CID 107456580
N-[[4-fluoro-3-[(4-iodopyrazol-1-yl)methyl]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 107456580) has the molecular formula C15H19FIN3 and a molecular weight of 387.24 g/mol. Its IUPAC name is N-[[4-fluoro-3-[(4-iodopyrazol-1-yl)methyl]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-fluoro-3-[(4-iodopyrazol-1-yl)methyl]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107456580 |
| Molecular Formula | C15H19FIN3 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-[[4-fluoro-3-[(4-iodopyrazol-1-yl)methyl]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccc(F)c(Cn2cc(I)cn2)c1 |
| InChI | InChI=1S/C15H19FIN3/c1-15(2,3)18-7-11-4-5-14(16)12(6-11)9-20-10-13(17)8-19-20/h4-6,8,10,18H,7,9H2,1-3H3 |
| InChIKey | BLEMFUZMSQSUAR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|