C16H20BrFN2 — CID 66405391
N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrol-3-yl]methyl]-2-methylpropan-2-amine (PubChem CID 66405391) has the molecular formula C16H20BrFN2 and a molecular weight of 339.25 g/mol. Its IUPAC name is N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrol-3-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrol-3-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 66405391 |
| Molecular Formula | C16H20BrFN2 |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrol-3-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccn(Cc2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C16H20BrFN2/c1-16(2,3)19-9-12-6-7-20(10-12)11-13-8-14(17)4-5-15(13)18/h4-8,10,19H,9,11H2,1-3H3 |
| InChIKey | OPYFANVJCMTATD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |