C13H14BrFN2 — CID 66397706
N-[(5-bromo-2-fluorophenyl)methyl]-1-(1-methylpyrrol-3-yl)methanamine (PubChem CID 66397706) has the molecular formula C13H14BrFN2 and a molecular weight of 297.17 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-1-(1-methylpyrrol-3-yl)methanamine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(1-methylpyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 66397706 |
| Molecular Formula | C13H14BrFN2 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(1-methylpyrrol-3-yl)methanamine |
| SMILES | Cn1ccc(CNCc2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C13H14BrFN2/c1-17-5-4-10(9-17)7-16-8-11-6-12(14)2-3-13(11)15/h2-6,9,16H,7-8H2,1H3 |
| InChIKey | ISNCTPJVIIWGRK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |