C12H7ClFIN4 — CID 138522291
2-chloro-1-[(6-fluoro-2-pyridinyl)methyl]-6-iodoimidazo[4,5-b]pyridine (PubChem CID 138522291) has the molecular formula C12H7ClFIN4 and a molecular weight of 388.57 g/mol. Its IUPAC name is 2-chloro-1-[(6-fluoro-2-pyridinyl)methyl]-6-iodoimidazo[4,5-b]pyridine.
| Compound Name | 2-chloro-1-[(6-fluoro-2-pyridinyl)methyl]-6-iodoimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138522291 |
| Molecular Formula | C12H7ClFIN4 |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 2-chloro-1-[(6-fluoro-2-pyridinyl)methyl]-6-iodoimidazo[4,5-b]pyridine |
| SMILES | Fc1cccc(Cn2c(Cl)nc3ncc(I)cc32)n1 |
| InChI | InChI=1S/C12H7ClFIN4/c13-12-18-11-9(4-7(15)5-16-11)19(12)6-8-2-1-3-10(14)17-8/h1-5H,6H2 |
| InChIKey | NVEBKXYTRBVUOX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|