C14H11FIN3O — CID 138522215
[1-[(3-fluorophenyl)methyl]-6-iodoimidazo[4,5-b]pyridin-2-yl]methanol (PubChem CID 138522215) has the molecular formula C14H11FIN3O and a molecular weight of 383.16 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl]-6-iodoimidazo[4,5-b]pyridin-2-yl]methanol.
| Compound Name | [1-[(3-fluorophenyl)methyl]-6-iodoimidazo[4,5-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 138522215 |
| Molecular Formula | C14H11FIN3O |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl]-6-iodoimidazo[4,5-b]pyridin-2-yl]methanol |
| SMILES | OCc1nc2ncc(I)cc2n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H11FIN3O/c15-10-3-1-2-9(4-10)7-19-12-5-11(16)6-17-14(12)18-13(19)8-20/h1-6,20H,7-8H2 |
| InChIKey | YTESZPCQPOXCIS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|