C7H7N3O2S — CID 175992852
formic acid;thieno[3,2-d]pyrimidin-4-amine (PubChem CID 175992852) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is formic acid;thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | formic acid;thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175992852 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | formic acid;thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2ccsc12.O=CO |
| InChI | InChI=1S/C6H5N3S.CH2O2/c7-6-5-4(1-2-10-5)8-3-9-6;2-1-3/h1-3H,(H2,7,8,9);1H,(H,2,3) |
| InChIKey | CWMQKOZSIASMGR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|