C20H13N3O2S — CID 175995945
4-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-4-yl]benzonitrile (PubChem CID 175995945) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-4-yl]benzonitrile.
| Compound Name | 4-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 175995945 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cncc3c2ccn3S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H13N3O2S/c21-12-15-6-8-16(9-7-15)19-13-22-14-20-18(19)10-11-23(20)26(24,25)17-4-2-1-3-5-17/h1-11,13-14H |
| InChIKey | SLRZZOQYVGKIOE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |