C15H9N3 — CID 174888795
4-(1,7-naphthyridin-5-yl)benzonitrile (PubChem CID 174888795) has the molecular formula C15H9N3 and a molecular weight of 231.26 g/mol. Its IUPAC name is 4-(1,7-naphthyridin-5-yl)benzonitrile.
| Compound Name | 4-(1,7-naphthyridin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 174888795 |
| Molecular Formula | C15H9N3 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-(1,7-naphthyridin-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cncc3ncccc23)cc1 |
| InChI | InChI=1S/C15H9N3/c16-8-11-3-5-12(6-4-11)14-9-17-10-15-13(14)2-1-7-18-15/h1-7,9-10H |
| InChIKey | BGRQEGXWFZZRDN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |