C14H8N2S — CID 132554240
4-thieno[2,3-b]pyridin-4-ylbenzonitrile (PubChem CID 132554240) has the molecular formula C14H8N2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-thieno[2,3-b]pyridin-4-ylbenzonitrile.
| Compound Name | 4-thieno[2,3-b]pyridin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 132554240 |
| Molecular Formula | C14H8N2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-thieno[2,3-b]pyridin-4-ylbenzonitrile |
| SMILES | N#Cc1ccc(-c2ccnc3sccc23)cc1 |
| InChI | InChI=1S/C14H8N2S/c15-9-10-1-3-11(4-2-10)12-5-7-16-14-13(12)6-8-17-14/h1-8H |
| InChIKey | JPTJWSNBARREOD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |