About 5-iodo-1,7-naphthyridine
5-iodo-1,7-naphthyridine (PubChem CID 126647714) has the molecular formula C8H5IN2
and a molecular weight of 256.05 g/mol. Its IUPAC name is 5-iodo-1,7-naphthyridine.
Molecular Properties
| Compound Name | 5-iodo-1,7-naphthyridine |
| PubChem CID | 126647714 |
| Molecular Formula | C8H5IN2 |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 5-iodo-1,7-naphthyridine |
| SMILES | Ic1cncc2ncccc12 |
| InChI | InChI=1S/C8H5IN2/c9-7-4-10-5-8-6(7)2-1-3-11-8/h1-5H |
| InChIKey | BACXBGIUTLBODN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,7-naphthyridine?
The IUPAC name of 5-iodo-1,7-naphthyridine (CID 126647714) is 5-iodo-1,7-naphthyridine.
What is the SMILES notation for 5-iodo-1,7-naphthyridine?
The canonical SMILES for 5-iodo-1,7-naphthyridine is Ic1cncc2ncccc12.
What is the InChIKey of 5-iodo-1,7-naphthyridine?
The InChIKey is BACXBGIUTLBODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IN2/c9-7-4-10-5-8-6(7)2-1-3-11-8/h1-5H.
What are the key properties of 5-iodo-1,7-naphthyridine?
5-iodo-1,7-naphthyridine has a molecular weight of 256.05 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,7-naphthyridine is sourced from PubChem (CID 126647714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).