About pyrrolo[3,4-d][1]benzazepine
pyrrolo[3,4-d][1]benzazepine (PubChem CID 70490498) has the molecular formula C12H8N2
and a molecular weight of 180.21 g/mol. Its IUPAC name is pyrrolo[3,4-d][1]benzazepine.
Molecular Properties
| Compound Name | pyrrolo[3,4-d][1]benzazepine |
| PubChem CID | 70490498 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | pyrrolo[3,4-d][1]benzazepine |
| SMILES | c1ccc2c3cncc-3ccnc2c1 |
| InChI | InChI=1S/C12H8N2/c1-2-4-12-10(3-1)11-8-13-7-9(11)5-6-14-12/h1-8H |
| InChIKey | UCCLTBMPXRBAPX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[3,4-d][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,4-d][1]benzazepine?
The IUPAC name of pyrrolo[3,4-d][1]benzazepine (CID 70490498) is pyrrolo[3,4-d][1]benzazepine.
What is the SMILES notation for pyrrolo[3,4-d][1]benzazepine?
The canonical SMILES for pyrrolo[3,4-d][1]benzazepine is c1ccc2c3cncc-3ccnc2c1.
What is the InChIKey of pyrrolo[3,4-d][1]benzazepine?
The InChIKey is UCCLTBMPXRBAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2/c1-2-4-12-10(3-1)11-8-13-7-9(11)5-6-14-12/h1-8H.
What are the key properties of pyrrolo[3,4-d][1]benzazepine?
pyrrolo[3,4-d][1]benzazepine has a molecular weight of 180.21 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,4-d][1]benzazepine is sourced from PubChem (CID 70490498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).