C20H21N5O2 — CID 175996111
4-[1-(3-methoxybenzoyl)-2,3-dihydropyrrolo[2,3-c]pyridin-4-yl]piperazine-1-carbonitrile (PubChem CID 175996111) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[1-(3-methoxybenzoyl)-2,3-dihydropyrrolo[2,3-c]pyridin-4-yl]piperazine-1-carbonitrile.
| Compound Name | 4-[1-(3-methoxybenzoyl)-2,3-dihydropyrrolo[2,3-c]pyridin-4-yl]piperazine-1-carbonitrile |
|---|---|
| PubChem CID | 175996111 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-[1-(3-methoxybenzoyl)-2,3-dihydropyrrolo[2,3-c]pyridin-4-yl]piperazine-1-carbonitrile |
| SMILES | COc1cccc(C(=O)N2CCc3c(N4CCN(C#N)CC4)cncc32)c1 |
| InChI | InChI=1S/C20H21N5O2/c1-27-16-4-2-3-15(11-16)20(26)25-6-5-17-18(12-22-13-19(17)25)24-9-7-23(14-21)8-10-24/h2-4,11-13H,5-10H2,1H3 |
| InChIKey | IXLPKIBVOFCAJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|