C8H12N6 — CID 175997383
2-N-propylimidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 175997383) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-N-propylimidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-propylimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 175997383 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-N-propylimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCCNc1nc(N)c2nccn2n1 |
| InChI | InChI=1S/C8H12N6/c1-2-3-11-8-12-6(9)7-10-4-5-14(7)13-8/h4-5H,2-3H2,1H3,(H3,9,11,12,13) |
| InChIKey | JHYIOFQWMAGJBQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|