C30H38FN6O5P — CID 175997928
ditert-butyl 1-[5-[8-[[(1R,2R)-2-fluorocyclopropanecarbonyl]amino]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-4-yl]-4-methyl-2-pyridinyl]propyl phosphate (PubChem CID 175997928) has the molecular formula C30H38FN6O5P and a molecular weight of 612.64 g/mol. Its IUPAC name is ditert-butyl 1-[5-[8-[[(1R,2R)-2-fluorocyclopropanecarbonyl]amino]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-4-yl]-4-methyl-2-pyridinyl]propyl phosphate.
| Compound Name | ditert-butyl 1-[5-[8-[[(1R,2R)-2-fluorocyclopropanecarbonyl]amino]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-4-yl]-4-methyl-2-pyridinyl]propyl phosphate |
|---|---|
| PubChem CID | 175997928 |
| Molecular Formula | C30H38FN6O5P |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | ditert-butyl 1-[5-[8-[[(1R,2R)-2-fluorocyclopropanecarbonyl]amino]-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-4-yl]-4-methyl-2-pyridinyl]propyl phosphate |
| SMILES | CCC(OP(=O)(OC(C)(C)C)OC(C)(C)C)c1cc(C)c(-c2cc3cnc(NC(=O)[C@H]4C[C@H]4F)cc3n3ncnc23)cn1 |
| InChI | InChI=1S/C30H38FN6O5P/c1-9-25(40-43(39,41-29(3,4)5)42-30(6,7)8)23-10-17(2)21(15-32-23)19-11-18-14-33-26(36-28(38)20-12-22(20)31)13-24(18)37-27(19)34-16-35-37/h10-11,13-16,20,22,25H,9,12H2,1-8H3,(H,33,36,38)/t20-,22+,25?/m0/s1 |
| InChIKey | WNEUNMUYWSXGHI-IZEQZHGBSA-N |
| XLogP | 7.15 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|