C23H20ClFN4O2 — CID 175998330
1-[4-[6-chloro-7-(3-ethenyl-5-hydroxyphenyl)-8-fluoroquinazolin-4-yl]piperazin-1-yl]-2-deuterioprop-2-en-1-one (PubChem CID 175998330) has the molecular formula C23H20ClFN4O2 and a molecular weight of 439.90 g/mol. Its IUPAC name is 1-[4-[6-chloro-7-(3-ethenyl-5-hydroxyphenyl)-8-fluoroquinazolin-4-yl]piperazin-1-yl]-2-deuterioprop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-7-(3-ethenyl-5-hydroxyphenyl)-8-fluoroquinazolin-4-yl]piperazin-1-yl]-2-deuterioprop-2-en-1-one |
|---|---|
| PubChem CID | 175998330 |
| Molecular Formula | C23H20ClFN4O2 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-[4-[6-chloro-7-(3-ethenyl-5-hydroxyphenyl)-8-fluoroquinazolin-4-yl]piperazin-1-yl]-2-deuterioprop-2-en-1-one |
| SMILES | [2H]C(=C)C(=O)N1CCN(c2ncnc3c(F)c(-c4cc(O)cc(C=C)c4)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C23H20ClFN4O2/c1-3-14-9-15(11-16(30)10-14)20-18(24)12-17-22(21(20)25)26-13-27-23(17)29-7-5-28(6-8-29)19(31)4-2/h3-4,9-13,30H,1-2,5-8H2/i4D |
| InChIKey | KASUUQPNKORLSR-QYKNYGDISA-N |
| XLogP | 4.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|