C35H54N2O5 — CID 175999805
tert-butyl N-[1-[[4-hexoxy-3-(2-hexoxyphenyl)benzoyl]amino]pentan-3-yl]carbamate (PubChem CID 175999805) has the molecular formula C35H54N2O5 and a molecular weight of 582.83 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-hexoxy-3-(2-hexoxyphenyl)benzoyl]amino]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[4-hexoxy-3-(2-hexoxyphenyl)benzoyl]amino]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 175999805 |
| Molecular Formula | C35H54N2O5 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.40 |
| IUPAC Name | tert-butyl N-[1-[[4-hexoxy-3-(2-hexoxyphenyl)benzoyl]amino]pentan-3-yl]carbamate |
| SMILES | CCCCCCOc1ccccc1-c1cc(C(=O)NCCC(CC)NC(=O)OC(C)(C)C)ccc1OCCCCCC |
| InChI | InChI=1S/C35H54N2O5/c1-7-10-12-16-24-40-31-19-15-14-18-29(31)30-26-27(20-21-32(30)41-25-17-13-11-8-2)33(38)36-23-22-28(9-3)37-34(39)42-35(4,5)6/h14-15,18-21,26,28H,7-13,16-17,22-25H2,1-6H3,(H,36,38)(H,37,39) |
| InChIKey | KQGTVQHWPMDTSW-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|