C21H25N7 — CID 176501665
N-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine (PubChem CID 176501665) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine.
| Compound Name | N-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine |
|---|---|
| PubChem CID | 176501665 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-(6-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine |
| SMILES | Cc1cc(NC2C3CN4CCN(C3)CC2(c2ccccc2)C4)c2nncn2n1 |
| InChI | InChI=1S/C21H25N7/c1-15-9-18(20-24-22-14-28(20)25-15)23-19-16-10-26-7-8-27(11-16)13-21(19,12-26)17-5-3-2-4-6-17/h2-6,9,14,16,19,23H,7-8,10-13H2,1H3 |
| InChIKey | FDVDVJTXEDQZKO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |