C22H28N6OS — CID 176502019
(1R,9S)-5-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]-11-(1,3-thiazol-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 176502019) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is (1R,9S)-5-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]-11-(1,3-thiazol-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]-11-(1,3-thiazol-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 176502019 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (1R,9S)-5-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]-11-(1,3-thiazol-4-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(Cc1cnn(C)c1)Cc1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(Cc2cscn2)C1 |
| InChI | InChI=1S/C22H28N6OS/c1-25(7-17-6-24-26(2)8-17)11-18-3-4-21-19-5-16(10-28(21)22(18)29)9-27(12-19)13-20-14-30-15-23-20/h3-4,6,8,14-16,19H,5,7,9-13H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | JAWBFOITIPLRON-QFBILLFUSA-N |
| XLogP | 2.29 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |