C22H28N6O2 — CID 176501952
(1R,9S)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-11-[(1-methylpyrazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 176501952) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is (1R,9S)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-11-[(1-methylpyrazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-11-[(1-methylpyrazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 176501952 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (1R,9S)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-11-[(1-methylpyrazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(Cc1ccon1)Cc1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(Cc2cnn(C)c2)C1 |
| InChI | InChI=1S/C22H28N6O2/c1-25(15-20-5-6-30-24-20)13-18-3-4-21-19-7-16(12-28(21)22(18)29)10-27(14-19)11-17-8-23-26(2)9-17/h3-6,8-9,16,19H,7,10-15H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | CNUZYVNMKHJCIO-QFBILLFUSA-N |
| XLogP | 1.82 |
| TPSA | 72.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |