C23H28N4O3 — CID 175644486
(1R,9S)-11-(cyclopent-3-ene-1-carbonyl)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 175644486) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (1R,9S)-11-(cyclopent-3-ene-1-carbonyl)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-(cyclopent-3-ene-1-carbonyl)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 175644486 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (1R,9S)-11-(cyclopent-3-ene-1-carbonyl)-5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(Cc1ccon1)Cc1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(C(=O)C2CC=CC2)C1 |
| InChI | InChI=1S/C23H28N4O3/c1-25(15-20-8-9-30-24-20)13-18-6-7-21-19-10-16(12-27(21)23(18)29)11-26(14-19)22(28)17-4-2-3-5-17/h2-3,6-9,16-17,19H,4-5,10-15H2,1H3/t16-,19+/m0/s1 |
| InChIKey | WRUHLAMZJHHMPD-QFBILLFUSA-N |
| XLogP | 2.38 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|