C16H26N6O — CID 176502530
[1-[3-[(6,7-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)amino]propyl]piperidin-2-yl]methanol (PubChem CID 176502530) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is [1-[3-[(6,7-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)amino]propyl]piperidin-2-yl]methanol.
| Compound Name | [1-[3-[(6,7-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)amino]propyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 176502530 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [1-[3-[(6,7-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)amino]propyl]piperidin-2-yl]methanol |
| SMILES | Cc1nn2cnnc2c(NCCCN2CCCCC2CO)c1C |
| InChI | InChI=1S/C16H26N6O/c1-12-13(2)20-22-11-18-19-16(22)15(12)17-7-5-9-21-8-4-3-6-14(21)10-23/h11,14,17,23H,3-10H2,1-2H3 |
| InChIKey | AYXZIXUZMRLJKN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|