C19H20N4O4S — CID 176504405
7-(2-methoxy-5-pyrazol-1-ylphenyl)sulfonyl-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one (PubChem CID 176504405) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 7-(2-methoxy-5-pyrazol-1-ylphenyl)sulfonyl-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one.
| Compound Name | 7-(2-methoxy-5-pyrazol-1-ylphenyl)sulfonyl-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one |
|---|---|
| PubChem CID | 176504405 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 7-(2-methoxy-5-pyrazol-1-ylphenyl)sulfonyl-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one |
| SMILES | COc1ccc(-n2cccn2)cc1S(=O)(=O)N1CCc2cc(=O)n(C)cc2C1 |
| InChI | InChI=1S/C19H20N4O4S/c1-21-12-15-13-22(9-6-14(15)10-19(21)24)28(25,26)18-11-16(4-5-17(18)27-2)23-8-3-7-20-23/h3-5,7-8,10-12H,6,9,13H2,1-2H3 |
| InChIKey | UUNNPDXFUAJDSF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|