C21H23N3O4S — CID 176506156
5-[2-(3-methoxyphenyl)acetyl]-10,13-dimethyl-8-thia-5,10,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-diene-11,14-dione (PubChem CID 176506156) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 5-[2-(3-methoxyphenyl)acetyl]-10,13-dimethyl-8-thia-5,10,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-diene-11,14-dione.
| Compound Name | 5-[2-(3-methoxyphenyl)acetyl]-10,13-dimethyl-8-thia-5,10,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-diene-11,14-dione |
|---|---|
| PubChem CID | 176506156 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 5-[2-(3-methoxyphenyl)acetyl]-10,13-dimethyl-8-thia-5,10,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7)-diene-11,14-dione |
| SMILES | COc1cccc(CC(=O)N2CCc3c(sc4c3C(=O)N(C)CC(=O)N4C)C2)c1 |
| InChI | InChI=1S/C21H23N3O4S/c1-22-12-18(26)23(2)21-19(20(22)27)15-7-8-24(11-16(15)29-21)17(25)10-13-5-4-6-14(9-13)28-3/h4-6,9H,7-8,10-12H2,1-3H3 |
| InChIKey | NBBGPXPERYVXIA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |