C24H26FN3O4 — CID 176506796
1-[3-[(3aS,5R,6R,7aR)-5-(2-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]imidazolidin-2-one (PubChem CID 176506796) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is 1-[3-[(3aS,5R,6R,7aR)-5-(2-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]imidazolidin-2-one.
| Compound Name | 1-[3-[(3aS,5R,6R,7aR)-5-(2-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 176506796 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[3-[(3aS,5R,6R,7aR)-5-(2-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]imidazolidin-2-one |
| SMILES | O=C(c1cccc(N2CCNC2=O)c1)N1C[C@H]2C[C@@H](Oc3ccccc3F)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C24H26FN3O4/c25-19-6-1-2-7-21(19)32-22-12-17-14-27(13-16(17)11-20(22)29)23(30)15-4-3-5-18(10-15)28-9-8-26-24(28)31/h1-7,10,16-17,20,22,29H,8-9,11-14H2,(H,26,31)/t16-,17+,20+,22+/m0/s1 |
| InChIKey | RXOCHPDECBPXMK-VTAPXXACSA-N |
| XLogP | 2.65 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |