C26H32N2O4 — CID 176506893
3-[4-[2-hydroxy-3-[4-(3-hydroxypropyl)piperazin-1-yl]propoxy]naphthalen-1-yl]phenol (PubChem CID 176506893) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 3-[4-[2-hydroxy-3-[4-(3-hydroxypropyl)piperazin-1-yl]propoxy]naphthalen-1-yl]phenol.
| Compound Name | 3-[4-[2-hydroxy-3-[4-(3-hydroxypropyl)piperazin-1-yl]propoxy]naphthalen-1-yl]phenol |
|---|---|
| PubChem CID | 176506893 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-[4-[2-hydroxy-3-[4-(3-hydroxypropyl)piperazin-1-yl]propoxy]naphthalen-1-yl]phenol |
| SMILES | OCCCN1CCN(CC(O)COc2ccc(-c3cccc(O)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H32N2O4/c29-16-4-11-27-12-14-28(15-13-27)18-22(31)19-32-26-10-9-23(20-5-3-6-21(30)17-20)24-7-1-2-8-25(24)26/h1-3,5-10,17,22,29-31H,4,11-16,18-19H2 |
| InChIKey | GXSWCIPIRMSHPY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |