C29H29N3O3 — CID 176507451
3-(4-benzhydrylpiperazin-1-yl)-N-(2-oxochromen-6-yl)propanamide (PubChem CID 176507451) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-N-(2-oxochromen-6-yl)propanamide.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-N-(2-oxochromen-6-yl)propanamide |
|---|---|
| PubChem CID | 176507451 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-N-(2-oxochromen-6-yl)propanamide |
| SMILES | O=C(CCN1CCN(C(c2ccccc2)c2ccccc2)CC1)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C29H29N3O3/c33-27(30-25-12-13-26-24(21-25)11-14-28(34)35-26)15-16-31-17-19-32(20-18-31)29(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,21,29H,15-20H2,(H,30,33) |
| InChIKey | RGSKDQYYCWIBSM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|