C17H11Cl2NO3S — CID 3864431
2-(2,5-dichlorophenyl)sulfanyl-N-(2-oxochromen-6-yl)acetamide (PubChem CID 3864431) has the molecular formula C17H11Cl2NO3S and a molecular weight of 380.25 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 3864431 |
| Molecular Formula | C17H11Cl2NO3S |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-(2-oxochromen-6-yl)acetamide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C17H11Cl2NO3S/c18-11-2-4-13(19)15(8-11)24-9-16(21)20-12-3-5-14-10(7-12)1-6-17(22)23-14/h1-8H,9H2,(H,20,21) |
| InChIKey | ADUCOTWHPYADKB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|